@article{article, title  = {{Nanostructure of CaO-(Na2O)-Al2O3-SiO2-H2O gels revealed by multinuclear solid-state magic angle spinning and multiple quantum magic angle spinning nuclear magnetic resonance spectroscopy}},

 publisher = {{American Chemical Society (ACS)}},

 url = {{http://eprints.whiterose.ac.uk/157832/ }},

 year = {{2020}},

 month = {{1}},

 author = {{Walkley B and Page SJ and Rees GJ and Provis JL and Hanna JV}},

 doi = {{10.1021/acs.jpcc.9b10133}},

 volume = {{124}},

 journal = {{The Journal of Physical Chemistry C}},

 issue = {{2}},

 pages = {{1681-1694}},

 note = {{Accessed on 2024/09/20}}}